C12H13FN2O2S — CID 107021942
1-(4-fluoro-3-sulfanylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 107021942) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(4-fluoro-3-sulfanylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluoro-3-sulfanylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107021942 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(4-fluoro-3-sulfanylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C12H13FN2O2S/c13-8-4-3-7(6-10(8)18)12(17)15-5-1-2-9(15)11(14)16/h3-4,6,9,18H,1-2,5H2,(H2,14,16) |
| InChIKey | SGRSTUCGMODFFZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|