C16H20FNOS — CID 107027342
(2-cyclopentylpyrrolidin-1-yl)-(4-fluoro-3-sulfanylphenyl)methanone (PubChem CID 107027342) has the molecular formula C16H20FNOS and a molecular weight of 293.41 g/mol. Its IUPAC name is (2-cyclopentylpyrrolidin-1-yl)-(4-fluoro-3-sulfanylphenyl)methanone.
| Compound Name | (2-cyclopentylpyrrolidin-1-yl)-(4-fluoro-3-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107027342 |
| Molecular Formula | C16H20FNOS |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (2-cyclopentylpyrrolidin-1-yl)-(4-fluoro-3-sulfanylphenyl)methanone |
| SMILES | O=C(c1ccc(F)c(S)c1)N1CCCC1C1CCCC1 |
| InChI | InChI=1S/C16H20FNOS/c17-13-8-7-12(10-15(13)20)16(19)18-9-3-6-14(18)11-4-1-2-5-11/h7-8,10-11,14,20H,1-6,9H2 |
| InChIKey | LBDMBPOFCQMGSI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|