C17H19F4NO — CID 60589048
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 60589048) has the molecular formula C17H19F4NO and a molecular weight of 329.34 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 60589048 |
| Molecular Formula | C17H19F4NO |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(F)c(C(F)(F)F)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C17H19F4NO/c18-14-8-7-12(10-13(14)17(19,20)21)16(23)22-9-3-5-11-4-1-2-6-15(11)22/h7-8,10-11,15H,1-6,9H2 |
| InChIKey | ISROXKLVHSEVPC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |