C18H23NO2 — CID 95334900
1-[4-[(2S)-2-cyclopentylpyrrolidine-1-carbonyl]phenyl]ethanone (PubChem CID 95334900) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[4-[(2S)-2-cyclopentylpyrrolidine-1-carbonyl]phenyl]ethanone.
| Compound Name | 1-[4-[(2S)-2-cyclopentylpyrrolidine-1-carbonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 95334900 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[4-[(2S)-2-cyclopentylpyrrolidine-1-carbonyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC[C@H]2C2CCCC2)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-13(20)14-8-10-16(11-9-14)18(21)19-12-4-7-17(19)15-5-2-3-6-15/h8-11,15,17H,2-7,12H2,1H3/t17-/m0/s1 |
| InChIKey | LAGHDTNUIVPRKI-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |