C17H24N2O — CID 43627930
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-(aminomethyl)phenyl]methanone (PubChem CID 43627930) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-(aminomethyl)phenyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-(aminomethyl)phenyl]methanone |
|---|---|
| PubChem CID | 43627930 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-(aminomethyl)phenyl]methanone |
| SMILES | NCc1ccc(C(=O)N2CCCC3CCCCC32)cc1 |
| InChI | InChI=1S/C17H24N2O/c18-12-13-7-9-15(10-8-13)17(20)19-11-3-5-14-4-1-2-6-16(14)19/h7-10,14,16H,1-6,11-12,18H2 |
| InChIKey | RKRVUTGLIBPSQV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |