C19H19F3N2O — CID 124690117
[(2R,4R)-4-amino-2-methylpiperidin-1-yl]-[4-(3,4,5-trifluorophenyl)phenyl]methanone (PubChem CID 124690117) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is [(2R,4R)-4-amino-2-methylpiperidin-1-yl]-[4-(3,4,5-trifluorophenyl)phenyl]methanone.
| Compound Name | [(2R,4R)-4-amino-2-methylpiperidin-1-yl]-[4-(3,4,5-trifluorophenyl)phenyl]methanone |
|---|---|
| PubChem CID | 124690117 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(2R,4R)-4-amino-2-methylpiperidin-1-yl]-[4-(3,4,5-trifluorophenyl)phenyl]methanone |
| SMILES | C[C@@H]1C[C@H](N)CCN1C(=O)c1ccc(-c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H19F3N2O/c1-11-8-15(23)6-7-24(11)19(25)13-4-2-12(3-5-13)14-9-16(20)18(22)17(21)10-14/h2-5,9-11,15H,6-8,23H2,1H3/t11-,15-/m1/s1 |
| InChIKey | VMGGYTPTGPIHIK-IAQYHMDHSA-N |
| XLogP | 3.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|