C13H15Cl2FN2O — CID 124689802
[(2R,4R)-4-amino-2-methylpiperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone (PubChem CID 124689802) has the molecular formula C13H15Cl2FN2O and a molecular weight of 305.18 g/mol. Its IUPAC name is [(2R,4R)-4-amino-2-methylpiperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone.
| Compound Name | [(2R,4R)-4-amino-2-methylpiperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 124689802 |
| Molecular Formula | C13H15Cl2FN2O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [(2R,4R)-4-amino-2-methylpiperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone |
| SMILES | C[C@@H]1C[C@H](N)CCN1C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2FN2O/c1-7-4-8(17)2-3-18(7)13(19)9-5-12(16)11(15)6-10(9)14/h5-8H,2-4,17H2,1H3/t7-,8-/m1/s1 |
| InChIKey | RZRRUXZCAVOBOP-HTQZYQBOSA-N |
| XLogP | 3.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|