About 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one
1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one (PubChem CID 124694483) has the molecular formula C17H22FN3O2
and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one |
| PubChem CID | 124694483 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one |
| SMILES | C[C@H]1C[C@H](N)CCN1C(=O)c1cc(N2CCCC2=O)ccc1F |
| InChI | InChI=1S/C17H22FN3O2/c1-11-9-12(19)6-8-20(11)17(23)14-10-13(4-5-15(14)18)21-7-2-3-16(21)22/h4-5,10-12H,2-3,6-9,19H2,1H3/t11-,12+/m0/s1 |
| InChIKey | JSUYVCABMMHXQV-NWDGAFQWSA-N |
| XLogP | 1.90 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one?
The IUPAC name of 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one (CID 124694483) is 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one?
The canonical SMILES for 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one is C[C@H]1C[C@H](N)CCN1C(=O)c1cc(N2CCCC2=O)ccc1F.
What is the InChIKey of 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one?
The InChIKey is JSUYVCABMMHXQV-NWDGAFQWSA-N. The full InChI is InChI=1S/C17H22FN3O2/c1-11-9-12(19)6-8-20(11)17(23)14-10-13(4-5-15(14)18)21-7-2-3-16(21)22/h4-5,10-12H,2-3,6-9,19H2,1H3/t11-,12+/m0/s1.
What are the key properties of 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one?
1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one has a molecular weight of 319.38 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2S,4R)-4-amino-2-methylpiperidine-1-carbonyl]-4-fluorophenyl]pyrrolidin-2-one is sourced from PubChem (CID 124694483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).