C12H15FN2O — CID 60974941
(5-amino-2-fluorophenyl)-(2-methylpyrrolidin-1-yl)methanone (PubChem CID 60974941) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is (5-amino-2-fluorophenyl)-(2-methylpyrrolidin-1-yl)methanone.
| Compound Name | (5-amino-2-fluorophenyl)-(2-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 60974941 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (5-amino-2-fluorophenyl)-(2-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCCN1C(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C12H15FN2O/c1-8-3-2-6-15(8)12(16)10-7-9(14)4-5-11(10)13/h4-5,7-8H,2-3,6,14H2,1H3 |
| InChIKey | FMOHVOHRKZRLHN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|