C12H12F3NO — CID 110728179
(2-methylpyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 110728179) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is (2-methylpyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (2-methylpyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110728179 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (2-methylpyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | CC1CCCN1C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H12F3NO/c1-7-3-2-6-16(7)12(17)8-4-5-9(13)11(15)10(8)14/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | IHPLEZNIAGBSPU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|