C13H15F2NO — CID 2347956
(2,4-difluorophenyl)-[(2R)-2-methylpiperidin-1-yl]methanone (PubChem CID 2347956) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[(2R)-2-methylpiperidin-1-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[(2R)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 2347956 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (2,4-difluorophenyl)-[(2R)-2-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCCN1C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2NO/c1-9-4-2-3-7-16(9)13(17)11-6-5-10(14)8-12(11)15/h5-6,8-9H,2-4,7H2,1H3/t9-/m1/s1 |
| InChIKey | GKEYHHSCTGBSCU-SECBINFHSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |