C19H27BFNO3 — CID 176731092
[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 176731092) has the molecular formula C19H27BFNO3 and a molecular weight of 347.24 g/mol. Its IUPAC name is [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(2-methylpiperidin-1-yl)methanone.
| Compound Name | [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 176731092 |
| Molecular Formula | C19H27BFNO3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCCN1C(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H27BFNO3/c1-13-8-6-7-11-22(13)17(23)15-10-9-14(12-16(15)21)20-24-18(2,3)19(4,5)25-20/h9-10,12-13H,6-8,11H2,1-5H3 |
| InChIKey | IPOICXWLEDODOV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|