C18H27BClFN2O3 — CID 176731114
(3-aminopiperidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride (PubChem CID 176731114) has the molecular formula C18H27BClFN2O3 and a molecular weight of 384.69 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 176731114 |
| Molecular Formula | C18H27BClFN2O3 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCCC(N)C3)c(F)c2)OC1(C)C.Cl |
| InChI | InChI=1S/C18H26BFN2O3.ClH/c1-17(2)18(3,4)25-19(24-17)12-7-8-14(15(20)10-12)16(23)22-9-5-6-13(21)11-22;/h7-8,10,13H,5-6,9,11,21H2,1-4H3;1H |
| InChIKey | ZFFGCMCXBMXCSV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|