C19H28BFN2O3 — CID 176731131
(4-ethylpiperazin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 176731131) has the molecular formula C19H28BFN2O3 and a molecular weight of 362.25 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 176731131 |
| Molecular Formula | C19H28BFN2O3 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CCN1CCN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)CC1 |
| InChI | InChI=1S/C19H28BFN2O3/c1-6-22-9-11-23(12-10-22)17(24)15-8-7-14(13-16(15)21)20-25-18(2,3)19(4,5)26-20/h7-8,13H,6,9-12H2,1-5H3 |
| InChIKey | JMGWZXKJKUTFMW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|