C19H26BF2NO3 — CID 166611419
(4,4-difluoropiperidin-1-yl)-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 166611419) has the molecular formula C19H26BF2NO3 and a molecular weight of 365.23 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 166611419 |
| Molecular Formula | C19H26BF2NO3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H26BF2NO3/c1-13-12-14(20-25-17(2,3)18(4,5)26-20)6-7-15(13)16(24)23-10-8-19(21,22)9-11-23/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | KBVAYKJIBLBTOK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|