C18H24BF2NO3 — CID 169452497
(3,3-difluoropyrrolidin-1-yl)-[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 169452497) has the molecular formula C18H24BF2NO3 and a molecular weight of 351.20 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 169452497 |
| Molecular Formula | C18H24BF2NO3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | Cc1cccc(C(=O)N2CCC(F)(F)C2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BF2NO3/c1-12-7-6-8-13(15(23)22-10-9-18(20,21)11-22)14(12)19-24-16(2,3)17(4,5)25-19/h6-8H,9-11H2,1-5H3 |
| InChIKey | JYQCHHOQFCLQHM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|