C22H26BF2NO3 — CID 171396815
(3,3-difluoropiperidin-1-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methanone (PubChem CID 171396815) has the molecular formula C22H26BF2NO3 and a molecular weight of 401.26 g/mol. Its IUPAC name is (3,3-difluoropiperidin-1-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methanone.
| Compound Name | (3,3-difluoropiperidin-1-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 171396815 |
| Molecular Formula | C22H26BF2NO3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (3,3-difluoropiperidin-1-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methanone |
| SMILES | CC1(C)OB(c2cccc3cc(C(=O)N4CCCC(F)(F)C4)ccc23)OC1(C)C |
| InChI | InChI=1S/C22H26BF2NO3/c1-20(2)21(3,4)29-23(28-20)18-8-5-7-15-13-16(9-10-17(15)18)19(27)26-12-6-11-22(24,25)14-26/h5,7-10,13H,6,11-12,14H2,1-4H3 |
| InChIKey | CQXNGHWMTGQNMN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|