C18H23BClF2NO3 — CID 176731327
[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3,3-difluoropiperidin-1-yl)methanone (PubChem CID 176731327) has the molecular formula C18H23BClF2NO3 and a molecular weight of 385.65 g/mol. Its IUPAC name is [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3,3-difluoropiperidin-1-yl)methanone.
| Compound Name | [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3,3-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 176731327 |
| Molecular Formula | C18H23BClF2NO3 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3,3-difluoropiperidin-1-yl)methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCCC(F)(F)C3)cc2Cl)OC1(C)C |
| InChI | InChI=1S/C18H23BClF2NO3/c1-16(2)17(3,4)26-19(25-16)13-7-6-12(10-14(13)20)15(24)23-9-5-8-18(21,22)11-23/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | GTDBXFSRBDXHQC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|