C19H23BF5NO4 — CID 168678164
(3,3-difluoropiperidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methanone (PubChem CID 168678164) has the molecular formula C19H23BF5NO4 and a molecular weight of 435.20 g/mol. Its IUPAC name is (3,3-difluoropiperidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methanone.
| Compound Name | (3,3-difluoropiperidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 168678164 |
| Molecular Formula | C19H23BF5NO4 |
| Molecular Weight | 435.20 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3,3-difluoropiperidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCCC(F)(F)C3)c(OC(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C19H23BF5NO4/c1-16(2)17(3,4)30-20(29-16)12-6-7-13(14(10-12)28-19(23,24)25)15(27)26-9-5-8-18(21,22)11-26/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | UDTLWJRAGOPCAT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|