C16H22BF3O4 — CID 91526823
4,4,5,5-tetramethyl-2-[4-propoxy-3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane (PubChem CID 91526823) has the molecular formula C16H22BF3O4 and a molecular weight of 346.15 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-propoxy-3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-propoxy-3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 91526823 |
| Molecular Formula | C16H22BF3O4 |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-propoxy-3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
| SMILES | CCCOc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OC(F)(F)F |
| InChI | InChI=1S/C16H22BF3O4/c1-6-9-21-12-8-7-11(10-13(12)22-16(18,19)20)17-23-14(2,3)15(4,5)24-17/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | ZBYQPYZEUVEYFO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|