C17H25BO4 — CID 170534232
2-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-2,4,6-trien-1-one (PubChem CID 170534232) has the molecular formula C17H25BO4 and a molecular weight of 304.20 g/mol. Its IUPAC name is 2-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 170534232 |
| Molecular Formula | C17H25BO4 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCOc1ccc(B2OC(C)(C)C(C)(C)O2)ccc1=O |
| InChI | InChI=1S/C17H25BO4/c1-6-7-12-20-15-11-9-13(8-10-14(15)19)18-21-16(2,3)17(4,5)22-18/h8-11H,6-7,12H2,1-5H3 |
| InChIKey | FGKGOQMPYXBJNT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|