About CID 102196609
CID 102196609 (PubChem CID 102196609) has the molecular formula C17H26BO2
and a molecular weight of 273.20 g/mol.
Molecular Properties
| Compound Name | CID 102196609 |
| PubChem CID | 102196609 |
| Molecular Formula | C17H26BO2 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | — |
| SMILES | CCCC[CH]c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H26BO2/c1-6-7-8-9-14-10-12-15(13-11-14)18-19-16(2,3)17(4,5)20-18/h9-13H,6-8H2,1-5H3 |
| InChIKey | DWOASKYABNOJJV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 102196609 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102196609?
The IUPAC name of CID 102196609 (CID 102196609) is not available.
What is the SMILES notation for CID 102196609?
The canonical SMILES for CID 102196609 is CCCC[CH]c1ccc(B2OC(C)(C)C(C)(C)O2)cc1.
What is the InChIKey of CID 102196609?
The InChIKey is DWOASKYABNOJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26BO2/c1-6-7-8-9-14-10-12-15(13-11-14)18-19-16(2,3)17(4,5)20-18/h9-13H,6-8H2,1-5H3.
What are the key properties of CID 102196609?
CID 102196609 has a molecular weight of 273.20 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102196609 is sourced from PubChem (CID 102196609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).