C17H26BO2 — CID 102196609
CID 102196609 (PubChem CID 102196609) has the molecular formula C17H26BO2 and a molecular weight of 273.20 g/mol.
| Compound Name | CID 102196609 |
|---|---|
| PubChem CID | 102196609 |
| Molecular Formula | C17H26BO2 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | — |
| SMILES | CCCC[CH]c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H26BO2/c1-6-7-8-9-14-10-12-15(13-11-14)18-19-16(2,3)17(4,5)20-18/h9-13H,6-8H2,1-5H3 |
| InChIKey | DWOASKYABNOJJV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|