C32H39B2NO4 — CID 142373817
N-(4-ethenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline (PubChem CID 142373817) has the molecular formula C32H39B2NO4 and a molecular weight of 523.29 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline.
| Compound Name | N-(4-ethenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 142373817 |
| Molecular Formula | C32H39B2NO4 |
| Molecular Weight | 523.29 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | N-(4-ethenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline |
| SMILES | C=Cc1ccc(N(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C32H39B2NO4/c1-10-23-11-17-26(18-12-23)35(27-19-13-24(14-20-27)33-36-29(2,3)30(4,5)37-33)28-21-15-25(16-22-28)34-38-31(6,7)32(8,9)39-34/h10-22H,1H2,2-9H3 |
| InChIKey | ZSQNAFWQCCVGOV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.29 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|