C31H32BNO2 — CID 140957040
N-(4-methylphenyl)-N-(4-phenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 140957040) has the molecular formula C31H32BNO2 and a molecular weight of 461.41 g/mol. Its IUPAC name is N-(4-methylphenyl)-N-(4-phenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-(4-methylphenyl)-N-(4-phenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 140957040 |
| Molecular Formula | C31H32BNO2 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-(4-methylphenyl)-N-(4-phenylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | Cc1ccc(N(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H32BNO2/c1-23-11-17-27(18-12-23)33(28-19-13-25(14-20-28)24-9-7-6-8-10-24)29-21-15-26(16-22-29)32-34-30(2,3)31(4,5)35-32/h6-22H,1-5H3 |
| InChIKey | HAXNUFGRKNJSOS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|