C40H36BNO2 — CID 90305757
N-(4-phenylphenyl)-N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]naphthalen-2-amine (PubChem CID 90305757) has the molecular formula C40H36BNO2 and a molecular weight of 573.55 g/mol. Its IUPAC name is N-(4-phenylphenyl)-N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]naphthalen-2-amine.
| Compound Name | N-(4-phenylphenyl)-N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 90305757 |
| Molecular Formula | C40H36BNO2 |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | N-(4-phenylphenyl)-N-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]naphthalen-2-amine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc5ccccc5c4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C40H36BNO2/c1-39(2)40(3,4)44-41(43-39)35-21-14-31(15-22-35)33-18-25-37(26-19-33)42(38-27-20-30-12-8-9-13-34(30)28-38)36-23-16-32(17-24-36)29-10-6-5-7-11-29/h5-28H,1-4H3 |
| InChIKey | TVQIWZDSZKBYDB-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|