C38H38BNO2 — CID 174115756
N,N-bis(4-phenylphenyl)-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 174115756) has the molecular formula C38H38BNO2 and a molecular weight of 551.54 g/mol. Its IUPAC name is N,N-bis(4-phenylphenyl)-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N,N-bis(4-phenylphenyl)-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 174115756 |
| Molecular Formula | C38H38BNO2 |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | N,N-bis(4-phenylphenyl)-4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC(C)C1(C)OB(c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C38H38BNO2/c1-28(2)38(5)37(3,4)41-39(42-38)33-20-26-36(27-21-33)40(34-22-16-31(17-23-34)29-12-8-6-9-13-29)35-24-18-32(19-25-35)30-14-10-7-11-15-30/h6-28H,1-5H3 |
| InChIKey | VTJAZLJUQVUDHF-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|