C40H49B2NO4 — CID 153472793
N-[4-(4-butylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline (PubChem CID 153472793) has the molecular formula C40H49B2NO4 and a molecular weight of 629.46 g/mol. Its IUPAC name is N-[4-(4-butylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline.
| Compound Name | N-[4-(4-butylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 153472793 |
| Molecular Formula | C40H49B2NO4 |
| Molecular Weight | 629.46 g/mol |
| Exact Mass | 629.38 |
| IUPAC Name | N-[4-(4-butylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline |
| SMILES | CCCCc1ccc(-c2ccc(N(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H49B2NO4/c1-10-11-12-29-13-15-30(16-14-29)31-17-23-34(24-18-31)43(35-25-19-32(20-26-35)41-44-37(2,3)38(4,5)45-41)36-27-21-33(22-28-36)42-46-39(6,7)40(8,9)47-42/h13-28H,10-12H2,1-9H3 |
| InChIKey | CGCJBOCFDWSYGQ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.46 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|