C48H57B2FN2O4 — CID 162474758
4-N-(4-fluorophenyl)-4-N-(4-hexylphenyl)-1-N,1-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,4-diamine (PubChem CID 162474758) has the molecular formula C48H57B2FN2O4 and a molecular weight of 766.62 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-4-N-(4-hexylphenyl)-1-N,1-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-4-N-(4-hexylphenyl)-1-N,1-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 162474758 |
| Molecular Formula | C48H57B2FN2O4 |
| Molecular Weight | 766.62 g/mol |
| Exact Mass | 766.45 |
| IUPAC Name | 4-N-(4-fluorophenyl)-4-N-(4-hexylphenyl)-1-N,1-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,4-diamine |
| SMILES | CCCCCCc1ccc(N(c2ccc(F)cc2)c2ccc(N(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H57B2FN2O4/c1-10-11-12-13-14-35-15-23-39(24-16-35)52(42-29-21-38(51)22-30-42)43-31-33-44(34-32-43)53(40-25-17-36(18-26-40)49-54-45(2,3)46(4,5)55-49)41-27-19-37(20-28-41)50-56-47(6,7)48(8,9)57-50/h15-34H,10-14H2,1-9H3 |
| InChIKey | LBUZNAIHFAHHGJ-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.62 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|