C53H68BNO2 — CID 178088787
N-[4-(2-butyl-4-pentylphenyl)phenyl]-N-[4-(2,4-dibutylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 178088787) has the molecular formula C53H68BNO2 and a molecular weight of 761.94 g/mol. Its IUPAC name is N-[4-(2-butyl-4-pentylphenyl)phenyl]-N-[4-(2,4-dibutylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-[4-(2-butyl-4-pentylphenyl)phenyl]-N-[4-(2,4-dibutylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 178088787 |
| Molecular Formula | C53H68BNO2 |
| Molecular Weight | 761.94 g/mol |
| Exact Mass | 761.53 |
| IUPAC Name | N-[4-(2-butyl-4-pentylphenyl)phenyl]-N-[4-(2,4-dibutylphenyl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CCCCCc1ccc(-c2ccc(N(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(-c4ccc(CCCC)cc4CCCC)cc3)cc2)c(CCCC)c1 |
| InChI | InChI=1S/C53H68BNO2/c1-9-13-17-19-41-23-37-51(45(39-41)21-16-12-4)43-26-32-48(33-27-43)55(49-34-28-46(29-35-49)54-56-52(5,6)53(7,8)57-54)47-30-24-42(25-31-47)50-36-22-40(18-14-10-2)38-44(50)20-15-11-3/h22-39H,9-21H2,1-8H3 |
| InChIKey | KIAAHGLHPDMBDX-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.94 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|