C21H35BO2 — CID 150064659
4,4,5,5-tetramethyl-2-(2-methyl-5-octylphenyl)-1,3,2-dioxaborolane (PubChem CID 150064659) has the molecular formula C21H35BO2 and a molecular weight of 330.32 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(2-methyl-5-octylphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(2-methyl-5-octylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 150064659 |
| Molecular Formula | C21H35BO2 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(2-methyl-5-octylphenyl)-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCc1ccc(C)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H35BO2/c1-7-8-9-10-11-12-13-18-15-14-17(2)19(16-18)22-23-20(3,4)21(5,6)24-22/h14-16H,7-13H2,1-6H3 |
| InChIKey | DOAFGLMIDLOWNA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|