C15H25BO2S — CID 67952902
4,4,5,5-tetramethyl-2-(4-pentylthiophen-2-yl)-1,3,2-dioxaborolane (PubChem CID 67952902) has the molecular formula C15H25BO2S and a molecular weight of 280.24 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4-pentylthiophen-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4-pentylthiophen-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 67952902 |
| Molecular Formula | C15H25BO2S |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4-pentylthiophen-2-yl)-1,3,2-dioxaborolane |
| SMILES | CCCCCc1csc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H25BO2S/c1-6-7-8-9-12-10-13(19-11-12)16-17-14(2,3)15(4,5)18-16/h10-11H,6-9H2,1-5H3 |
| InChIKey | BWQAZCXFHOYENQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|