C13H21BO2S — CID 59695620
2-(4-hexylthiophen-2-yl)-1,3,2-dioxaborinane (PubChem CID 59695620) has the molecular formula C13H21BO2S and a molecular weight of 252.19 g/mol. Its IUPAC name is 2-(4-hexylthiophen-2-yl)-1,3,2-dioxaborinane.
| Compound Name | 2-(4-hexylthiophen-2-yl)-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 59695620 |
| Molecular Formula | C13H21BO2S |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(4-hexylthiophen-2-yl)-1,3,2-dioxaborinane |
| SMILES | CCCCCCc1csc(B2OCCCO2)c1 |
| InChI | InChI=1S/C13H21BO2S/c1-2-3-4-5-7-12-10-13(17-11-12)14-15-8-6-9-16-14/h10-11H,2-9H2,1H3 |
| InChIKey | HPAWQKVXLLVKRE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|