C28H38S2 — CID 101038762
4-hexyl-2-[4-(4-hexylthiophen-2-yl)-2,5-dimethylphenyl]thiophene (PubChem CID 101038762) has the molecular formula C28H38S2 and a molecular weight of 438.75 g/mol. Its IUPAC name is 4-hexyl-2-[4-(4-hexylthiophen-2-yl)-2,5-dimethylphenyl]thiophene.
| Compound Name | 4-hexyl-2-[4-(4-hexylthiophen-2-yl)-2,5-dimethylphenyl]thiophene |
|---|---|
| PubChem CID | 101038762 |
| Molecular Formula | C28H38S2 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 4-hexyl-2-[4-(4-hexylthiophen-2-yl)-2,5-dimethylphenyl]thiophene |
| SMILES | CCCCCCc1csc(-c2cc(C)c(-c3cc(CCCCCC)cs3)cc2C)c1 |
| InChI | InChI=1S/C28H38S2/c1-5-7-9-11-13-23-17-27(29-19-23)25-15-22(4)26(16-21(25)3)28-18-24(20-30-28)14-12-10-8-6-2/h15-20H,5-14H2,1-4H3 |
| InChIKey | RLPAONPSRHMDPP-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|