C26H32N2S4 — CID 102412162
5-(4-hexylthiophen-2-yl)-2-[5-(4-hexylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole (PubChem CID 102412162) has the molecular formula C26H32N2S4 and a molecular weight of 500.82 g/mol. Its IUPAC name is 5-(4-hexylthiophen-2-yl)-2-[5-(4-hexylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole.
| Compound Name | 5-(4-hexylthiophen-2-yl)-2-[5-(4-hexylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 102412162 |
| Molecular Formula | C26H32N2S4 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 5-(4-hexylthiophen-2-yl)-2-[5-(4-hexylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole |
| SMILES | CCCCCCc1csc(-c2cnc(-c3ncc(-c4cc(CCCCCC)cs4)s3)s2)c1 |
| InChI | InChI=1S/C26H32N2S4/c1-3-5-7-9-11-19-13-21(29-17-19)23-15-27-25(31-23)26-28-16-24(32-26)22-14-20(18-30-22)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3 |
| InChIKey | VVLGHEOGHKROOC-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|