C48H48Br2N2S6 — CID 102190158
5,8-bis(5-bromothiophen-2-yl)-2,3-bis[5-(4-octylthiophen-2-yl)thiophen-2-yl]quinoxaline (PubChem CID 102190158) has the molecular formula C48H48Br2N2S6 and a molecular weight of 1005.14 g/mol. Its IUPAC name is 5,8-bis(5-bromothiophen-2-yl)-2,3-bis[5-(4-octylthiophen-2-yl)thiophen-2-yl]quinoxaline.
| Compound Name | 5,8-bis(5-bromothiophen-2-yl)-2,3-bis[5-(4-octylthiophen-2-yl)thiophen-2-yl]quinoxaline |
|---|---|
| PubChem CID | 102190158 |
| Molecular Formula | C48H48Br2N2S6 |
| Molecular Weight | 1005.14 g/mol |
| Exact Mass | 1002.05 |
| IUPAC Name | 5,8-bis(5-bromothiophen-2-yl)-2,3-bis[5-(4-octylthiophen-2-yl)thiophen-2-yl]quinoxaline |
| SMILES | CCCCCCCCc1csc(-c2ccc(-c3nc4c(-c5ccc(Br)s5)ccc(-c5ccc(Br)s5)c4nc3-c3ccc(-c4cc(CCCCCCCC)cs4)s3)s2)c1 |
| InChI | InChI=1S/C48H48Br2N2S6/c1-3-5-7-9-11-13-15-31-27-41(53-29-31)37-19-21-39(55-37)47-48(40-22-20-38(56-40)42-28-32(30-54-42)16-14-12-10-8-6-4-2)52-46-34(36-24-26-44(50)58-36)18-17-33(45(46)51-47)35-23-25-43(49)57-35/h17-30H,3-16H2,1-2H3 |
| InChIKey | WPZXMOPPJPOMOU-UHFFFAOYSA-N |
| XLogP | 19.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.14 |
| LogP ≤ 5 | 19.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|