C78H112N2S7 — CID 101486889
4,7-bis[4-octyl-5-[4-octyl-5-(4-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 101486889) has the molecular formula C78H112N2S7 and a molecular weight of 1302.24 g/mol. Its IUPAC name is 4,7-bis[4-octyl-5-[4-octyl-5-(4-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[4-octyl-5-[4-octyl-5-(4-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 101486889 |
| Molecular Formula | C78H112N2S7 |
| Molecular Weight | 1302.24 g/mol |
| Exact Mass | 1300.69 |
| IUPAC Name | 4,7-bis[4-octyl-5-[4-octyl-5-(4-octylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCc1csc(-c2sc(-c3sc(-c4ccc(-c5cc(CCCCCCCC)c(-c6cc(CCCCCCCC)c(-c7cc(CCCCCCCC)cs7)s6)s5)c5nsnc45)cc3CCCCCCCC)cc2CCCCCCCC)c1 |
| InChI | InChI=1S/C78H112N2S7/c1-7-13-19-25-31-37-43-59-51-69(81-57-59)75-63(47-41-35-29-23-17-11-5)55-71(85-75)77-61(45-39-33-27-21-15-9-3)53-67(83-77)65-49-50-66(74-73(65)79-87-80-74)68-54-62(46-40-34-28-22-16-10-4)78(84-68)72-56-64(48-42-36-30-24-18-12-6)76(86-72)70-52-60(58-82-70)44-38-32-26-20-14-8-2/h49-58H,7-48H2,1-6H3 |
| InChIKey | VJZLLLJGAGIQNK-UHFFFAOYSA-N |
| XLogP | 29.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1302.24 |
| LogP ≤ 5 | 29.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|