C22H24N2S3 — CID 147935099
4-(4-hexyl-5-methylthiophen-2-yl)-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 147935099) has the molecular formula C22H24N2S3 and a molecular weight of 412.65 g/mol. Its IUPAC name is 4-(4-hexyl-5-methylthiophen-2-yl)-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-(4-hexyl-5-methylthiophen-2-yl)-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 147935099 |
| Molecular Formula | C22H24N2S3 |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4-(4-hexyl-5-methylthiophen-2-yl)-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCCc1cc(-c2ccc(-c3ccc(C)s3)c3nsnc23)sc1C |
| InChI | InChI=1S/C22H24N2S3/c1-4-5-6-7-8-16-13-20(26-15(16)3)18-11-10-17(19-12-9-14(2)25-19)21-22(18)24-27-23-21/h9-13H,4-8H2,1-3H3 |
| InChIKey | IKQKJQRKCMDNIZ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|