C31H42N4S3 — CID 102433734
2-[[3-hexyl-5-[7-(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylideneamino]-N,N-dimethylethanamine (PubChem CID 102433734) has the molecular formula C31H42N4S3 and a molecular weight of 566.91 g/mol. Its IUPAC name is 2-[[3-hexyl-5-[7-(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylideneamino]-N,N-dimethylethanamine.
| Compound Name | 2-[[3-hexyl-5-[7-(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylideneamino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 102433734 |
| Molecular Formula | C31H42N4S3 |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 2-[[3-hexyl-5-[7-(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]methylideneamino]-N,N-dimethylethanamine |
| SMILES | CCCCCCc1csc(-c2ccc(-c3cc(CCCCCC)c(/C=N/CCN(C)C)s3)c3nsnc23)c1 |
| InChI | InChI=1S/C31H42N4S3/c1-5-7-9-11-13-23-19-27(36-22-23)25-15-16-26(31-30(25)33-38-34-31)28-20-24(14-12-10-8-6-2)29(37-28)21-32-17-18-35(3)4/h15-16,19-22H,5-14,17-18H2,1-4H3/b32-21+ |
| InChIKey | DHZXAQQJUCUMAP-RUMWWMSVSA-N |
| XLogP | 9.37 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|