About disodium;(4-octylthiophen-2-yl)-dioxidoborane
disodium;(4-octylthiophen-2-yl)-dioxidoborane (PubChem CID 177471091) has the molecular formula C12H19BNa2O2S
and a molecular weight of 284.14 g/mol. Its IUPAC name is disodium;(4-octylthiophen-2-yl)-dioxidoborane.
Molecular Properties
| Compound Name | disodium;(4-octylthiophen-2-yl)-dioxidoborane |
| PubChem CID | 177471091 |
| Molecular Formula | C12H19BNa2O2S |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | disodium;(4-octylthiophen-2-yl)-dioxidoborane |
| SMILES | CCCCCCCCc1csc(B([O-])[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C12H19BO2S.2Na/c1-2-3-4-5-6-7-8-11-9-12(13(14)15)16-10-11;;/h9-10H,2-8H2,1H3;;/q-2;2*+1 |
| InChIKey | UOIAXCHUDXETSZ-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disodium;(4-octylthiophen-2-yl)-dioxidoborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(4-octylthiophen-2-yl)-dioxidoborane?
The IUPAC name of disodium;(4-octylthiophen-2-yl)-dioxidoborane (CID 177471091) is disodium;(4-octylthiophen-2-yl)-dioxidoborane.
What is the SMILES notation for disodium;(4-octylthiophen-2-yl)-dioxidoborane?
The canonical SMILES for disodium;(4-octylthiophen-2-yl)-dioxidoborane is CCCCCCCCc1csc(B([O-])[O-])c1.[Na+].[Na+].
What is the InChIKey of disodium;(4-octylthiophen-2-yl)-dioxidoborane?
The InChIKey is UOIAXCHUDXETSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BO2S.2Na/c1-2-3-4-5-6-7-8-11-9-12(13(14)15)16-10-11;;/h9-10H,2-8H2,1H3;;/q-2;2*+1.
What are the key properties of disodium;(4-octylthiophen-2-yl)-dioxidoborane?
disodium;(4-octylthiophen-2-yl)-dioxidoborane has a molecular weight of 284.14 g/mol, XLogP of -4.93, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(4-octylthiophen-2-yl)-dioxidoborane is sourced from PubChem (CID 177471091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).