C23H34OS2 — CID 118412629
1,1-bis(4-hexylthiophen-2-yl)propan-2-one (PubChem CID 118412629) has the molecular formula C23H34OS2 and a molecular weight of 390.66 g/mol. Its IUPAC name is 1,1-bis(4-hexylthiophen-2-yl)propan-2-one.
| Compound Name | 1,1-bis(4-hexylthiophen-2-yl)propan-2-one |
|---|---|
| PubChem CID | 118412629 |
| Molecular Formula | C23H34OS2 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1,1-bis(4-hexylthiophen-2-yl)propan-2-one |
| SMILES | CCCCCCc1csc(C(C(C)=O)c2cc(CCCCCC)cs2)c1 |
| InChI | InChI=1S/C23H34OS2/c1-4-6-8-10-12-19-14-21(25-16-19)23(18(3)24)22-15-20(17-26-22)13-11-9-7-5-2/h14-17,23H,4-13H2,1-3H3 |
| InChIKey | YIZCOUDGRQZAQO-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|