C15H17FOS2 — CID 87065877
2-(4-hexylthiophen-2-yl)thiophene-3-carbonyl fluoride (PubChem CID 87065877) has the molecular formula C15H17FOS2 and a molecular weight of 296.43 g/mol. Its IUPAC name is 2-(4-hexylthiophen-2-yl)thiophene-3-carbonyl fluoride.
| Compound Name | 2-(4-hexylthiophen-2-yl)thiophene-3-carbonyl fluoride |
|---|---|
| PubChem CID | 87065877 |
| Molecular Formula | C15H17FOS2 |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(4-hexylthiophen-2-yl)thiophene-3-carbonyl fluoride |
| SMILES | CCCCCCc1csc(-c2sccc2C(=O)F)c1 |
| InChI | InChI=1S/C15H17FOS2/c1-2-3-4-5-6-11-9-13(19-10-11)14-12(15(16)17)7-8-18-14/h7-10H,2-6H2,1H3 |
| InChIKey | WBQZVYKCGKNVRQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|