C30H32S6 — CID 130351900
4-(4-butylthiophen-2-yl)-11-(4-octylthiophen-2-yl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene (PubChem CID 130351900) has the molecular formula C30H32S6 and a molecular weight of 584.99 g/mol. Its IUPAC name is 4-(4-butylthiophen-2-yl)-11-(4-octylthiophen-2-yl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene.
| Compound Name | 4-(4-butylthiophen-2-yl)-11-(4-octylthiophen-2-yl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene |
|---|---|
| PubChem CID | 130351900 |
| Molecular Formula | C30H32S6 |
| Molecular Weight | 584.99 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | 4-(4-butylthiophen-2-yl)-11-(4-octylthiophen-2-yl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene |
| SMILES | CCCCCCCCc1csc(-c2cc3c(s2)sc2c4cc(-c5cc(CCCC)cs5)sc4sc32)c1 |
| InChI | InChI=1S/C30H32S6/c1-3-5-7-8-9-10-12-20-14-24(32-18-20)26-16-22-28-27(36-30(22)34-26)21-15-25(33-29(21)35-28)23-13-19(17-31-23)11-6-4-2/h13-18H,3-12H2,1-2H3 |
| InChIKey | DGDAOUZMJDTQGG-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.99 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|