C21H23NOS — CID 23354762
4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenol (PubChem CID 23354762) has the molecular formula C21H23NOS and a molecular weight of 337.49 g/mol. Its IUPAC name is 4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenol.
| Compound Name | 4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenol |
|---|---|
| PubChem CID | 23354762 |
| Molecular Formula | C21H23NOS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenol |
| SMILES | CCCCCCc1ccc(-c2ncc(-c3ccc(O)cc3)s2)cc1 |
| InChI | InChI=1S/C21H23NOS/c1-2-3-4-5-6-16-7-9-18(10-8-16)21-22-15-20(24-21)17-11-13-19(23)14-12-17/h7-15,23H,2-6H2,1H3 |
| InChIKey | SCSBQNZWYDGJGX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|