C32H43NO2S — CID 23354791
[4-[2-(4-octylphenyl)-1,3-thiazol-5-yl]phenyl] nonanoate (PubChem CID 23354791) has the molecular formula C32H43NO2S and a molecular weight of 505.77 g/mol. Its IUPAC name is [4-[2-(4-octylphenyl)-1,3-thiazol-5-yl]phenyl] nonanoate.
| Compound Name | [4-[2-(4-octylphenyl)-1,3-thiazol-5-yl]phenyl] nonanoate |
|---|---|
| PubChem CID | 23354791 |
| Molecular Formula | C32H43NO2S |
| Molecular Weight | 505.77 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | [4-[2-(4-octylphenyl)-1,3-thiazol-5-yl]phenyl] nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1ccc(-c2cnc(-c3ccc(CCCCCCCC)cc3)s2)cc1 |
| InChI | InChI=1S/C32H43NO2S/c1-3-5-7-9-11-13-15-26-17-19-28(20-18-26)32-33-25-30(36-32)27-21-23-29(24-22-27)35-31(34)16-14-12-10-8-6-4-2/h17-25H,3-16H2,1-2H3 |
| InChIKey | MCIDSAOYDCJMNI-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.77 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|