C27H37NOSSi — CID 19757573
3-[4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenoxy]propyl-trimethylsilane (PubChem CID 19757573) has the molecular formula C27H37NOSSi and a molecular weight of 451.75 g/mol. Its IUPAC name is 3-[4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenoxy]propyl-trimethylsilane.
| Compound Name | 3-[4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenoxy]propyl-trimethylsilane |
|---|---|
| PubChem CID | 19757573 |
| Molecular Formula | C27H37NOSSi |
| Molecular Weight | 451.75 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 3-[4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenoxy]propyl-trimethylsilane |
| SMILES | CCCCCCc1ccc(-c2ncc(-c3ccc(OCCC[Si](C)(C)C)cc3)s2)cc1 |
| InChI | InChI=1S/C27H37NOSSi/c1-5-6-7-8-10-22-11-13-24(14-12-22)27-28-21-26(30-27)23-15-17-25(18-16-23)29-19-9-20-31(2,3)4/h11-18,21H,5-10,19-20H2,1-4H3 |
| InChIKey | HBTZLUKNGIUOQG-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|