C31H43NO2SSi — CID 19757578
[4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenyl] 4-[butyl(dimethyl)silyl]butanoate (PubChem CID 19757578) has the molecular formula C31H43NO2SSi and a molecular weight of 521.84 g/mol. Its IUPAC name is [4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenyl] 4-[butyl(dimethyl)silyl]butanoate.
| Compound Name | [4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenyl] 4-[butyl(dimethyl)silyl]butanoate |
|---|---|
| PubChem CID | 19757578 |
| Molecular Formula | C31H43NO2SSi |
| Molecular Weight | 521.84 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | [4-[2-(4-hexylphenyl)-1,3-thiazol-5-yl]phenyl] 4-[butyl(dimethyl)silyl]butanoate |
| SMILES | CCCCCCc1ccc(-c2ncc(-c3ccc(OC(=O)CCC[Si](C)(C)CCCC)cc3)s2)cc1 |
| InChI | InChI=1S/C31H43NO2SSi/c1-5-7-9-10-12-25-14-16-27(17-15-25)31-32-24-29(35-31)26-18-20-28(21-19-26)34-30(33)13-11-23-36(3,4)22-8-6-2/h14-21,24H,5-13,22-23H2,1-4H3 |
| InChIKey | XLGTVWNCKFMXQP-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.84 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|