C31H35NO4S — CID 23432034
[4-[2-[4-[(E)-oct-2-enoyl]oxyphenyl]-1,3-thiazol-5-yl]phenyl] (E)-oct-2-enoate (PubChem CID 23432034) has the molecular formula C31H35NO4S and a molecular weight of 517.69 g/mol. Its IUPAC name is [4-[2-[4-[(E)-oct-2-enoyl]oxyphenyl]-1,3-thiazol-5-yl]phenyl] (E)-oct-2-enoate.
| Compound Name | [4-[2-[4-[(E)-oct-2-enoyl]oxyphenyl]-1,3-thiazol-5-yl]phenyl] (E)-oct-2-enoate |
|---|---|
| PubChem CID | 23432034 |
| Molecular Formula | C31H35NO4S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | [4-[2-[4-[(E)-oct-2-enoyl]oxyphenyl]-1,3-thiazol-5-yl]phenyl] (E)-oct-2-enoate |
| SMILES | CCCCC/C=C/C(=O)Oc1ccc(-c2cnc(-c3ccc(OC(=O)/C=C/CCCCC)cc3)s2)cc1 |
| InChI | InChI=1S/C31H35NO4S/c1-3-5-7-9-11-13-29(33)35-26-19-15-24(16-20-26)28-23-32-31(37-28)25-17-21-27(22-18-25)36-30(34)14-12-10-8-6-4-2/h11-23H,3-10H2,1-2H3/b13-11+,14-12+ |
| InChIKey | NXJMAZFRENLPOP-PHEQNACWSA-N |
| XLogP | 8.56 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|