C19H23NO2S — CID 23432344
[4-(5-butyl-1,3-thiazol-2-yl)phenyl] (E)-hex-2-enoate (PubChem CID 23432344) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is [4-(5-butyl-1,3-thiazol-2-yl)phenyl] (E)-hex-2-enoate.
| Compound Name | [4-(5-butyl-1,3-thiazol-2-yl)phenyl] (E)-hex-2-enoate |
|---|---|
| PubChem CID | 23432344 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [4-(5-butyl-1,3-thiazol-2-yl)phenyl] (E)-hex-2-enoate |
| SMILES | CCC/C=C/C(=O)Oc1ccc(-c2ncc(CCCC)s2)cc1 |
| InChI | InChI=1S/C19H23NO2S/c1-3-5-7-9-18(21)22-16-12-10-15(11-13-16)19-20-14-17(23-19)8-6-4-2/h7,9-14H,3-6,8H2,1-2H3/b9-7+ |
| InChIKey | WULRXDLKWVBALE-VQHVLOKHSA-N |
| XLogP | 5.41 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|