C18H23NOS — CID 23432183
2-[4-[(E)-hex-4-enoxy]phenyl]-5-propyl-1,3-thiazole (PubChem CID 23432183) has the molecular formula C18H23NOS and a molecular weight of 301.46 g/mol. Its IUPAC name is 2-[4-[(E)-hex-4-enoxy]phenyl]-5-propyl-1,3-thiazole.
| Compound Name | 2-[4-[(E)-hex-4-enoxy]phenyl]-5-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 23432183 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[4-[(E)-hex-4-enoxy]phenyl]-5-propyl-1,3-thiazole |
| SMILES | C/C=C/CCCOc1ccc(-c2ncc(CCC)s2)cc1 |
| InChI | InChI=1S/C18H23NOS/c1-3-5-6-7-13-20-16-11-9-15(10-12-16)18-19-14-17(21-18)8-4-2/h3,5,9-12,14H,4,6-8,13H2,1-2H3/b5-3+ |
| InChIKey | ODUFTBKNYDUMQC-HWKANZROSA-N |
| XLogP | 5.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|