C17H19NO2S — CID 54450667
[4-(5-propyl-1,3-thiazol-2-yl)phenyl] pent-2-enoate (PubChem CID 54450667) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is [4-(5-propyl-1,3-thiazol-2-yl)phenyl] pent-2-enoate.
| Compound Name | [4-(5-propyl-1,3-thiazol-2-yl)phenyl] pent-2-enoate |
|---|---|
| PubChem CID | 54450667 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [4-(5-propyl-1,3-thiazol-2-yl)phenyl] pent-2-enoate |
| SMILES | CCC=CC(=O)Oc1ccc(-c2ncc(CCC)s2)cc1 |
| InChI | InChI=1S/C17H19NO2S/c1-3-5-7-16(19)20-14-10-8-13(9-11-14)17-18-12-15(21-17)6-4-2/h5,7-12H,3-4,6H2,1-2H3 |
| InChIKey | WUSYXZIHGRSNII-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|